About 4-[4-(4-bromoanilino)-3,5-dimethylphenyl]-1,3-thiazol-2-amine
4-[4-(4-bromoanilino)-3,5-dimethylphenyl]-1,3-thiazol-2-amine (PubChem CID 174737012) has the molecular formula C17H16BrN3S
and a molecular weight of 374.31 g/mol. Its IUPAC name is 4-[4-(4-bromoanilino)-3,5-dimethylphenyl]-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-[4-(4-bromoanilino)-3,5-dimethylphenyl]-1,3-thiazol-2-amine |
| PubChem CID | 174737012 |
| Molecular Formula | C17H16BrN3S |
| Molecular Weight | 374.31 g/mol |
| Exact Mass | 373.02 |
| IUPAC Name | 4-[4-(4-bromoanilino)-3,5-dimethylphenyl]-1,3-thiazol-2-amine |
| SMILES | Cc1cc(-c2csc(N)n2)cc(C)c1Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C17H16BrN3S/c1-10-7-12(15-9-22-17(19)21-15)8-11(2)16(10)20-14-5-3-13(18)4-6-14/h3-9,20H,1-2H3,(H2,19,21) |
| InChIKey | UZUDKWLMLUHFLL-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.31 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[4-(4-bromoanilino)-3,5-dimethylphenyl]-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(4-bromoanilino)-3,5-dimethylphenyl]-1,3-thiazol-2-amine?
The IUPAC name of 4-[4-(4-bromoanilino)-3,5-dimethylphenyl]-1,3-thiazol-2-amine (CID 174737012) is 4-[4-(4-bromoanilino)-3,5-dimethylphenyl]-1,3-thiazol-2-amine.
What is the SMILES notation for 4-[4-(4-bromoanilino)-3,5-dimethylphenyl]-1,3-thiazol-2-amine?
The canonical SMILES for 4-[4-(4-bromoanilino)-3,5-dimethylphenyl]-1,3-thiazol-2-amine is Cc1cc(-c2csc(N)n2)cc(C)c1Nc1ccc(Br)cc1.
What is the InChIKey of 4-[4-(4-bromoanilino)-3,5-dimethylphenyl]-1,3-thiazol-2-amine?
The InChIKey is UZUDKWLMLUHFLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16BrN3S/c1-10-7-12(15-9-22-17(19)21-15)8-11(2)16(10)20-14-5-3-13(18)4-6-14/h3-9,20H,1-2H3,(H2,19,21).
What are the key properties of 4-[4-(4-bromoanilino)-3,5-dimethylphenyl]-1,3-thiazol-2-amine?
4-[4-(4-bromoanilino)-3,5-dimethylphenyl]-1,3-thiazol-2-amine has a molecular weight of 374.31 g/mol, XLogP of 5.52, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(4-bromoanilino)-3,5-dimethylphenyl]-1,3-thiazol-2-amine is sourced from PubChem (CID 174737012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).