C21H26N6OS2 — CID 17473707
5-(2-ethoxyanilino)-3-[[4-(pyridin-2-ylmethyl)piperazin-1-yl]methyl]-1,3,4-thiadiazole-2-thione (PubChem CID 17473707) has the molecular formula C21H26N6OS2 and a molecular weight of 442.61 g/mol. Its IUPAC name is 5-(2-ethoxyanilino)-3-[[4-(pyridin-2-ylmethyl)piperazin-1-yl]methyl]-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-(2-ethoxyanilino)-3-[[4-(pyridin-2-ylmethyl)piperazin-1-yl]methyl]-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 17473707 |
| Molecular Formula | C21H26N6OS2 |
| Molecular Weight | 442.61 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 5-(2-ethoxyanilino)-3-[[4-(pyridin-2-ylmethyl)piperazin-1-yl]methyl]-1,3,4-thiadiazole-2-thione |
| SMILES | CCOc1ccccc1Nc1nn(CN2CCN(Cc3ccccn3)CC2)c(=S)s1 |
| InChI | InChI=1S/C21H26N6OS2/c1-2-28-19-9-4-3-8-18(19)23-20-24-27(21(29)30-20)16-26-13-11-25(12-14-26)15-17-7-5-6-10-22-17/h3-10H,2,11-16H2,1H3,(H,23,24) |
| InChIKey | IPRDODNILYYFDE-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 58.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.61 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|