About 5-(1-fluorohexa-1,5-dien-3-yl)-1H-pyrazole-4-carboxylic acid
5-(1-fluorohexa-1,5-dien-3-yl)-1H-pyrazole-4-carboxylic acid (PubChem CID 174737140) has the molecular formula C10H11FN2O2
and a molecular weight of 210.21 g/mol. Its IUPAC name is 5-(1-fluorohexa-1,5-dien-3-yl)-1H-pyrazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-(1-fluorohexa-1,5-dien-3-yl)-1H-pyrazole-4-carboxylic acid |
| PubChem CID | 174737140 |
| Molecular Formula | C10H11FN2O2 |
| Molecular Weight | 210.21 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 5-(1-fluorohexa-1,5-dien-3-yl)-1H-pyrazole-4-carboxylic acid |
| SMILES | C=CCC(C=CF)c1[nH]ncc1C(=O)O |
| InChI | InChI=1S/C10H11FN2O2/c1-2-3-7(4-5-11)9-8(10(14)15)6-12-13-9/h2,4-7H,1,3H2,(H,12,13)(H,14,15) |
| InChIKey | AJIFMBHOSKHUHY-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.21 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-(1-fluorohexa-1,5-dien-3-yl)-1H-pyrazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-fluorohexa-1,5-dien-3-yl)-1H-pyrazole-4-carboxylic acid?
The IUPAC name of 5-(1-fluorohexa-1,5-dien-3-yl)-1H-pyrazole-4-carboxylic acid (CID 174737140) is 5-(1-fluorohexa-1,5-dien-3-yl)-1H-pyrazole-4-carboxylic acid.
What is the SMILES notation for 5-(1-fluorohexa-1,5-dien-3-yl)-1H-pyrazole-4-carboxylic acid?
The canonical SMILES for 5-(1-fluorohexa-1,5-dien-3-yl)-1H-pyrazole-4-carboxylic acid is C=CCC(C=CF)c1[nH]ncc1C(=O)O.
What is the InChIKey of 5-(1-fluorohexa-1,5-dien-3-yl)-1H-pyrazole-4-carboxylic acid?
The InChIKey is AJIFMBHOSKHUHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11FN2O2/c1-2-3-7(4-5-11)9-8(10(14)15)6-12-13-9/h2,4-7H,1,3H2,(H,12,13)(H,14,15).
What are the key properties of 5-(1-fluorohexa-1,5-dien-3-yl)-1H-pyrazole-4-carboxylic acid?
5-(1-fluorohexa-1,5-dien-3-yl)-1H-pyrazole-4-carboxylic acid has a molecular weight of 210.21 g/mol, XLogP of 2.25, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-fluorohexa-1,5-dien-3-yl)-1H-pyrazole-4-carboxylic acid is sourced from PubChem (CID 174737140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).