About bis(1H-benzimidazole);1,2-diethynylbenzene
bis(1H-benzimidazole);1,2-diethynylbenzene (PubChem CID 174737184) has the molecular formula C24H18N4
and a molecular weight of 362.44 g/mol. Its IUPAC name is bis(1H-benzimidazole);1,2-diethynylbenzene.
Molecular Properties
| Compound Name | bis(1H-benzimidazole);1,2-diethynylbenzene |
| PubChem CID | 174737184 |
| Molecular Formula | C24H18N4 |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | bis(1H-benzimidazole);1,2-diethynylbenzene |
| SMILES | C#Cc1ccccc1C#C.c1ccc2[nH]cnc2c1.c1ccc2[nH]cnc2c1 |
| InChI | InChI=1S/C10H6.2C7H6N2/c1-3-9-7-5-6-8-10(9)4-2;2*1-2-4-7-6(3-1)8-5-9-7/h1-2,5-8H;2*1-5H,(H,8,9) |
| InChIKey | ZEENBUCDPHEJFQ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze bis(1H-benzimidazole);1,2-diethynylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1H-benzimidazole);1,2-diethynylbenzene?
The IUPAC name of bis(1H-benzimidazole);1,2-diethynylbenzene (CID 174737184) is bis(1H-benzimidazole);1,2-diethynylbenzene.
What is the SMILES notation for bis(1H-benzimidazole);1,2-diethynylbenzene?
The canonical SMILES for bis(1H-benzimidazole);1,2-diethynylbenzene is C#Cc1ccccc1C#C.c1ccc2[nH]cnc2c1.c1ccc2[nH]cnc2c1.
What is the InChIKey of bis(1H-benzimidazole);1,2-diethynylbenzene?
The InChIKey is ZEENBUCDPHEJFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6.2C7H6N2/c1-3-9-7-5-6-8-10(9)4-2;2*1-2-4-7-6(3-1)8-5-9-7/h1-2,5-8H;2*1-5H,(H,8,9).
What are the key properties of bis(1H-benzimidazole);1,2-diethynylbenzene?
bis(1H-benzimidazole);1,2-diethynylbenzene has a molecular weight of 362.44 g/mol, XLogP of 4.78, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1H-benzimidazole);1,2-diethynylbenzene is sourced from PubChem (CID 174737184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).