About 2,4-difluoro-1,3-benzothiazol-6-ol
2,4-difluoro-1,3-benzothiazol-6-ol (PubChem CID 174737226) has the molecular formula C7H3F2NOS
and a molecular weight of 187.17 g/mol. Its IUPAC name is 2,4-difluoro-1,3-benzothiazol-6-ol.
Molecular Properties
| Compound Name | 2,4-difluoro-1,3-benzothiazol-6-ol |
| PubChem CID | 174737226 |
| Molecular Formula | C7H3F2NOS |
| Molecular Weight | 187.17 g/mol |
| Exact Mass | 186.99 |
| IUPAC Name | 2,4-difluoro-1,3-benzothiazol-6-ol |
| SMILES | Oc1cc(F)c2nc(F)sc2c1 |
| InChI | InChI=1S/C7H3F2NOS/c8-4-1-3(11)2-5-6(4)10-7(9)12-5/h1-2,11H |
| InChIKey | YWUDJOVSMAOXIL-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.17 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-difluoro-1,3-benzothiazol-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-difluoro-1,3-benzothiazol-6-ol?
The IUPAC name of 2,4-difluoro-1,3-benzothiazol-6-ol (CID 174737226) is 2,4-difluoro-1,3-benzothiazol-6-ol.
What is the SMILES notation for 2,4-difluoro-1,3-benzothiazol-6-ol?
The canonical SMILES for 2,4-difluoro-1,3-benzothiazol-6-ol is Oc1cc(F)c2nc(F)sc2c1.
What is the InChIKey of 2,4-difluoro-1,3-benzothiazol-6-ol?
The InChIKey is YWUDJOVSMAOXIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3F2NOS/c8-4-1-3(11)2-5-6(4)10-7(9)12-5/h1-2,11H.
What are the key properties of 2,4-difluoro-1,3-benzothiazol-6-ol?
2,4-difluoro-1,3-benzothiazol-6-ol has a molecular weight of 187.17 g/mol, XLogP of 2.28, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-difluoro-1,3-benzothiazol-6-ol is sourced from PubChem (CID 174737226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).