About (2-fluorophenyl)-(1,3-thiazol-5-yl)carbamic acid
(2-fluorophenyl)-(1,3-thiazol-5-yl)carbamic acid (PubChem CID 174737764) has the molecular formula C10H7FN2O2S
and a molecular weight of 238.24 g/mol. Its IUPAC name is (2-fluorophenyl)-(1,3-thiazol-5-yl)carbamic acid.
Molecular Properties
| Compound Name | (2-fluorophenyl)-(1,3-thiazol-5-yl)carbamic acid |
| PubChem CID | 174737764 |
| Molecular Formula | C10H7FN2O2S |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.02 |
| IUPAC Name | (2-fluorophenyl)-(1,3-thiazol-5-yl)carbamic acid |
| SMILES | O=C(O)N(c1cncs1)c1ccccc1F |
| InChI | InChI=1S/C10H7FN2O2S/c11-7-3-1-2-4-8(7)13(10(14)15)9-5-12-6-16-9/h1-6H,(H,14,15) |
| InChIKey | LSIHRNCFVQYUTN-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-fluorophenyl)-(1,3-thiazol-5-yl)carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluorophenyl)-(1,3-thiazol-5-yl)carbamic acid?
The IUPAC name of (2-fluorophenyl)-(1,3-thiazol-5-yl)carbamic acid (CID 174737764) is (2-fluorophenyl)-(1,3-thiazol-5-yl)carbamic acid.
What is the SMILES notation for (2-fluorophenyl)-(1,3-thiazol-5-yl)carbamic acid?
The canonical SMILES for (2-fluorophenyl)-(1,3-thiazol-5-yl)carbamic acid is O=C(O)N(c1cncs1)c1ccccc1F.
What is the InChIKey of (2-fluorophenyl)-(1,3-thiazol-5-yl)carbamic acid?
The InChIKey is LSIHRNCFVQYUTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7FN2O2S/c11-7-3-1-2-4-8(7)13(10(14)15)9-5-12-6-16-9/h1-6H,(H,14,15).
What are the key properties of (2-fluorophenyl)-(1,3-thiazol-5-yl)carbamic acid?
(2-fluorophenyl)-(1,3-thiazol-5-yl)carbamic acid has a molecular weight of 238.24 g/mol, XLogP of 3.10, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluorophenyl)-(1,3-thiazol-5-yl)carbamic acid is sourced from PubChem (CID 174737764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).