About octan-1-ol;sulfuric acid;zinc
octan-1-ol;sulfuric acid;zinc (PubChem CID 174737842) has the molecular formula C8H20O5SZn
and a molecular weight of 293.70 g/mol. Its IUPAC name is octan-1-ol;sulfuric acid;zinc.
Molecular Properties
| Compound Name | octan-1-ol;sulfuric acid;zinc |
| PubChem CID | 174737842 |
| Molecular Formula | C8H20O5SZn |
| Molecular Weight | 293.70 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | octan-1-ol;sulfuric acid;zinc |
| SMILES | CCCCCCCCO.O=S(=O)(O)O.[Zn] |
| InChI | InChI=1S/C8H18O.H2O4S.Zn/c1-2-3-4-5-6-7-8-9;1-5(2,3)4;/h9H,2-8H2,1H3;(H2,1,2,3,4); |
| InChIKey | BBAXHRIWSDGIQF-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.70 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze octan-1-ol;sulfuric acid;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octan-1-ol;sulfuric acid;zinc?
The IUPAC name of octan-1-ol;sulfuric acid;zinc (CID 174737842) is octan-1-ol;sulfuric acid;zinc.
What is the SMILES notation for octan-1-ol;sulfuric acid;zinc?
The canonical SMILES for octan-1-ol;sulfuric acid;zinc is CCCCCCCCO.O=S(=O)(O)O.[Zn].
What is the InChIKey of octan-1-ol;sulfuric acid;zinc?
The InChIKey is BBAXHRIWSDGIQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O.H2O4S.Zn/c1-2-3-4-5-6-7-8-9;1-5(2,3)4;/h9H,2-8H2,1H3;(H2,1,2,3,4);.
What are the key properties of octan-1-ol;sulfuric acid;zinc?
octan-1-ol;sulfuric acid;zinc has a molecular weight of 293.70 g/mol, XLogP of 1.68, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for octan-1-ol;sulfuric acid;zinc is sourced from PubChem (CID 174737842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).