About cyclohexyloxycyclohexane;oxane
cyclohexyloxycyclohexane;oxane (PubChem CID 174738256) has the molecular formula C17H32O2
and a molecular weight of 268.44 g/mol. Its IUPAC name is cyclohexyloxycyclohexane;oxane.
Molecular Properties
| Compound Name | cyclohexyloxycyclohexane;oxane |
| PubChem CID | 174738256 |
| Molecular Formula | C17H32O2 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.24 |
| IUPAC Name | cyclohexyloxycyclohexane;oxane |
| SMILES | C1CCC(OC2CCCCC2)CC1.C1CCOCC1 |
| InChI | InChI=1S/C12H22O.C5H10O/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-4-6-5-3-1/h11-12H,1-10H2;1-5H2 |
| InChIKey | JIWCEKJBLDRMIF-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclohexyloxycyclohexane;oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyloxycyclohexane;oxane?
The IUPAC name of cyclohexyloxycyclohexane;oxane (CID 174738256) is cyclohexyloxycyclohexane;oxane.
What is the SMILES notation for cyclohexyloxycyclohexane;oxane?
The canonical SMILES for cyclohexyloxycyclohexane;oxane is C1CCC(OC2CCCCC2)CC1.C1CCOCC1.
What is the InChIKey of cyclohexyloxycyclohexane;oxane?
The InChIKey is JIWCEKJBLDRMIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O.C5H10O/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-4-6-5-3-1/h11-12H,1-10H2;1-5H2.
What are the key properties of cyclohexyloxycyclohexane;oxane?
cyclohexyloxycyclohexane;oxane has a molecular weight of 268.44 g/mol, XLogP of 4.86, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyloxycyclohexane;oxane is sourced from PubChem (CID 174738256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).