C14H15Cl7 — CID 174738609
butane;1,5,7,8,9,10,10-heptachlorotricyclo[5.2.1.02,6]deca-3,8-diene (PubChem CID 174738609) has the molecular formula C14H15Cl7 and a molecular weight of 431.45 g/mol. Its IUPAC name is butane;1,5,7,8,9,10,10-heptachlorotricyclo[5.2.1.02,6]deca-3,8-diene.
| Compound Name | butane;1,5,7,8,9,10,10-heptachlorotricyclo[5.2.1.02,6]deca-3,8-diene |
|---|---|
| PubChem CID | 174738609 |
| Molecular Formula | C14H15Cl7 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 427.90 |
| IUPAC Name | butane;1,5,7,8,9,10,10-heptachlorotricyclo[5.2.1.02,6]deca-3,8-diene |
| SMILES | CCCC.ClC1=C(Cl)C2(Cl)C3C(Cl)C=CC3C1(Cl)C2(Cl)Cl |
| InChI | InChI=1S/C10H5Cl7.C4H10/c11-4-2-1-3-5(4)9(15)7(13)6(12)8(3,14)10(9,16)17;1-3-4-2/h1-5H;3-4H2,1-2H3 |
| InChIKey | KPLMCBWLIIFLBQ-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|