About 1-[5-ethenyl-2,3-bis[1-hydroxy-2-(oxiran-2-yl)ethyl]phenyl]-2-(oxiran-2-yl)ethanol
1-[5-ethenyl-2,3-bis[1-hydroxy-2-(oxiran-2-yl)ethyl]phenyl]-2-(oxiran-2-yl)ethanol (PubChem CID 174738716) has the molecular formula C20H26O6
and a molecular weight of 362.42 g/mol. Its IUPAC name is 1-[5-ethenyl-2,3-bis[1-hydroxy-2-(oxiran-2-yl)ethyl]phenyl]-2-(oxiran-2-yl)ethanol.
Molecular Properties
| Compound Name | 1-[5-ethenyl-2,3-bis[1-hydroxy-2-(oxiran-2-yl)ethyl]phenyl]-2-(oxiran-2-yl)ethanol |
| PubChem CID | 174738716 |
| Molecular Formula | C20H26O6 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 1-[5-ethenyl-2,3-bis[1-hydroxy-2-(oxiran-2-yl)ethyl]phenyl]-2-(oxiran-2-yl)ethanol |
| SMILES | C=Cc1cc(C(O)CC2CO2)c(C(O)CC2CO2)c(C(O)CC2CO2)c1 |
| InChI | InChI=1S/C20H26O6/c1-2-11-3-15(17(21)5-12-8-24-12)20(19(23)7-14-10-26-14)16(4-11)18(22)6-13-9-25-13/h2-4,12-14,17-19,21-23H,1,5-10H2 |
| InChIKey | MDKKMXGLZGNBKL-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 98.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-[5-ethenyl-2,3-bis[1-hydroxy-2-(oxiran-2-yl)ethyl]phenyl]-2-(oxiran-2-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-ethenyl-2,3-bis[1-hydroxy-2-(oxiran-2-yl)ethyl]phenyl]-2-(oxiran-2-yl)ethanol?
The IUPAC name of 1-[5-ethenyl-2,3-bis[1-hydroxy-2-(oxiran-2-yl)ethyl]phenyl]-2-(oxiran-2-yl)ethanol (CID 174738716) is 1-[5-ethenyl-2,3-bis[1-hydroxy-2-(oxiran-2-yl)ethyl]phenyl]-2-(oxiran-2-yl)ethanol.
What is the SMILES notation for 1-[5-ethenyl-2,3-bis[1-hydroxy-2-(oxiran-2-yl)ethyl]phenyl]-2-(oxiran-2-yl)ethanol?
The canonical SMILES for 1-[5-ethenyl-2,3-bis[1-hydroxy-2-(oxiran-2-yl)ethyl]phenyl]-2-(oxiran-2-yl)ethanol is C=Cc1cc(C(O)CC2CO2)c(C(O)CC2CO2)c(C(O)CC2CO2)c1.
What is the InChIKey of 1-[5-ethenyl-2,3-bis[1-hydroxy-2-(oxiran-2-yl)ethyl]phenyl]-2-(oxiran-2-yl)ethanol?
The InChIKey is MDKKMXGLZGNBKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26O6/c1-2-11-3-15(17(21)5-12-8-24-12)20(19(23)7-14-10-26-14)16(4-11)18(22)6-13-9-25-13/h2-4,12-14,17-19,21-23H,1,5-10H2.
What are the key properties of 1-[5-ethenyl-2,3-bis[1-hydroxy-2-(oxiran-2-yl)ethyl]phenyl]-2-(oxiran-2-yl)ethanol?
1-[5-ethenyl-2,3-bis[1-hydroxy-2-(oxiran-2-yl)ethyl]phenyl]-2-(oxiran-2-yl)ethanol has a molecular weight of 362.42 g/mol, XLogP of 1.80, 10 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-ethenyl-2,3-bis[1-hydroxy-2-(oxiran-2-yl)ethyl]phenyl]-2-(oxiran-2-yl)ethanol is sourced from PubChem (CID 174738716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).