About formyl 2-[(1S,2S)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]propanoate
formyl 2-[(1S,2S)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]propanoate (PubChem CID 174738799) has the molecular formula C14H20O4
and a molecular weight of 252.31 g/mol. Its IUPAC name is formyl 2-[(1S,2S)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]propanoate.
Molecular Properties
| Compound Name | formyl 2-[(1S,2S)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]propanoate |
| PubChem CID | 174738799 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | formyl 2-[(1S,2S)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]propanoate |
| SMILES | CC/C=C\C[C@@H]1C(=O)CC[C@@H]1C(C)C(=O)OC=O |
| InChI | InChI=1S/C14H20O4/c1-3-4-5-6-12-11(7-8-13(12)16)10(2)14(17)18-9-15/h4-5,9-12H,3,6-8H2,1-2H3/b5-4-/t10?,11-,12+/m1/s1 |
| InChIKey | IARTXLBMLYANFN-UITVGWHGSA-N |
| XLogP | 2.27 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze formyl 2-[(1S,2S)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formyl 2-[(1S,2S)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]propanoate?
The IUPAC name of formyl 2-[(1S,2S)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]propanoate (CID 174738799) is formyl 2-[(1S,2S)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]propanoate.
What is the SMILES notation for formyl 2-[(1S,2S)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]propanoate?
The canonical SMILES for formyl 2-[(1S,2S)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]propanoate is CC/C=C\C[C@@H]1C(=O)CC[C@@H]1C(C)C(=O)OC=O.
What is the InChIKey of formyl 2-[(1S,2S)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]propanoate?
The InChIKey is IARTXLBMLYANFN-UITVGWHGSA-N. The full InChI is InChI=1S/C14H20O4/c1-3-4-5-6-12-11(7-8-13(12)16)10(2)14(17)18-9-15/h4-5,9-12H,3,6-8H2,1-2H3/b5-4-/t10?,11-,12+/m1/s1.
What are the key properties of formyl 2-[(1S,2S)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]propanoate?
formyl 2-[(1S,2S)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]propanoate has a molecular weight of 252.31 g/mol, XLogP of 2.27, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for formyl 2-[(1S,2S)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]propanoate is sourced from PubChem (CID 174738799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).