About [1-(benzylideneamino)-2,2,2-trifluoroethyl] acetate
[1-(benzylideneamino)-2,2,2-trifluoroethyl] acetate (PubChem CID 174739081) has the molecular formula C11H10F3NO2
and a molecular weight of 245.20 g/mol. Its IUPAC name is [1-(benzylideneamino)-2,2,2-trifluoroethyl] acetate.
Molecular Properties
| Compound Name | [1-(benzylideneamino)-2,2,2-trifluoroethyl] acetate |
| PubChem CID | 174739081 |
| Molecular Formula | C11H10F3NO2 |
| Molecular Weight | 245.20 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | [1-(benzylideneamino)-2,2,2-trifluoroethyl] acetate |
| SMILES | CC(=O)OC(N=Cc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C11H10F3NO2/c1-8(16)17-10(11(12,13)14)15-7-9-5-3-2-4-6-9/h2-7,10H,1H3 |
| InChIKey | ALIIFKJYQUVUHR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.20 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze [1-(benzylideneamino)-2,2,2-trifluoroethyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(benzylideneamino)-2,2,2-trifluoroethyl] acetate?
The IUPAC name of [1-(benzylideneamino)-2,2,2-trifluoroethyl] acetate (CID 174739081) is [1-(benzylideneamino)-2,2,2-trifluoroethyl] acetate.
What is the SMILES notation for [1-(benzylideneamino)-2,2,2-trifluoroethyl] acetate?
The canonical SMILES for [1-(benzylideneamino)-2,2,2-trifluoroethyl] acetate is CC(=O)OC(N=Cc1ccccc1)C(F)(F)F.
What is the InChIKey of [1-(benzylideneamino)-2,2,2-trifluoroethyl] acetate?
The InChIKey is ALIIFKJYQUVUHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F3NO2/c1-8(16)17-10(11(12,13)14)15-7-9-5-3-2-4-6-9/h2-7,10H,1H3.
What are the key properties of [1-(benzylideneamino)-2,2,2-trifluoroethyl] acetate?
[1-(benzylideneamino)-2,2,2-trifluoroethyl] acetate has a molecular weight of 245.20 g/mol, XLogP of 2.56, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(benzylideneamino)-2,2,2-trifluoroethyl] acetate is sourced from PubChem (CID 174739081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).