About dihydroxy(diphenyl)silane;imidazolidine-2-thione
dihydroxy(diphenyl)silane;imidazolidine-2-thione (PubChem CID 174739293) has the molecular formula C15H18N2O2SSi
and a molecular weight of 318.47 g/mol. Its IUPAC name is dihydroxy(diphenyl)silane;imidazolidine-2-thione.
Molecular Properties
| Compound Name | dihydroxy(diphenyl)silane;imidazolidine-2-thione |
| PubChem CID | 174739293 |
| Molecular Formula | C15H18N2O2SSi |
| Molecular Weight | 318.47 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | dihydroxy(diphenyl)silane;imidazolidine-2-thione |
| SMILES | O[Si](O)(c1ccccc1)c1ccccc1.S=C1NCCN1 |
| InChI | InChI=1S/C12H12O2Si.C3H6N2S/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12;6-3-4-1-2-5-3/h1-10,13-14H;1-2H2,(H2,4,5,6) |
| InChIKey | JSDXOLZKIZKURZ-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.47 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze dihydroxy(diphenyl)silane;imidazolidine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxy(diphenyl)silane;imidazolidine-2-thione?
The IUPAC name of dihydroxy(diphenyl)silane;imidazolidine-2-thione (CID 174739293) is dihydroxy(diphenyl)silane;imidazolidine-2-thione.
What is the SMILES notation for dihydroxy(diphenyl)silane;imidazolidine-2-thione?
The canonical SMILES for dihydroxy(diphenyl)silane;imidazolidine-2-thione is O[Si](O)(c1ccccc1)c1ccccc1.S=C1NCCN1.
What is the InChIKey of dihydroxy(diphenyl)silane;imidazolidine-2-thione?
The InChIKey is JSDXOLZKIZKURZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O2Si.C3H6N2S/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12;6-3-4-1-2-5-3/h1-10,13-14H;1-2H2,(H2,4,5,6).
What are the key properties of dihydroxy(diphenyl)silane;imidazolidine-2-thione?
dihydroxy(diphenyl)silane;imidazolidine-2-thione has a molecular weight of 318.47 g/mol, XLogP of -0.31, 2 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy(diphenyl)silane;imidazolidine-2-thione is sourced from PubChem (CID 174739293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).