About 2,4,6-trimethylbenzoate;tris[(2-chlorophenyl)methyl]stannanylium
2,4,6-trimethylbenzoate;tris[(2-chlorophenyl)methyl]stannanylium (PubChem CID 174739646) has the molecular formula C31H29Cl3O2Sn
and a molecular weight of 658.64 g/mol. Its IUPAC name is 2,4,6-trimethylbenzoate;tris[(2-chlorophenyl)methyl]stannanylium.
Molecular Properties
| Compound Name | 2,4,6-trimethylbenzoate;tris[(2-chlorophenyl)methyl]stannanylium |
| PubChem CID | 174739646 |
| Molecular Formula | C31H29Cl3O2Sn |
| Molecular Weight | 658.64 g/mol |
| Exact Mass | 658.03 |
| IUPAC Name | 2,4,6-trimethylbenzoate;tris[(2-chlorophenyl)methyl]stannanylium |
| SMILES | Cc1cc(C)c(C(=O)[O-])c(C)c1.Clc1ccccc1C[Sn+](Cc1ccccc1Cl)Cc1ccccc1Cl |
| InChI | InChI=1S/C10H12O2.3C7H6Cl.Sn/c1-6-4-7(2)9(10(11)12)8(3)5-6;3*1-6-4-2-3-5-7(6)8;/h4-5H,1-3H3,(H,11,12);3*2-5H,1H2;/q;;;;+1/p-1 |
| InChIKey | DFRVBBSCALWOGC-UHFFFAOYSA-M |
| XLogP | 7.76 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 658.64 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4,6-trimethylbenzoate;tris[(2-chlorophenyl)methyl]stannanylium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,6-trimethylbenzoate;tris[(2-chlorophenyl)methyl]stannanylium?
The IUPAC name of 2,4,6-trimethylbenzoate;tris[(2-chlorophenyl)methyl]stannanylium (CID 174739646) is 2,4,6-trimethylbenzoate;tris[(2-chlorophenyl)methyl]stannanylium.
What is the SMILES notation for 2,4,6-trimethylbenzoate;tris[(2-chlorophenyl)methyl]stannanylium?
The canonical SMILES for 2,4,6-trimethylbenzoate;tris[(2-chlorophenyl)methyl]stannanylium is Cc1cc(C)c(C(=O)[O-])c(C)c1.Clc1ccccc1C[Sn+](Cc1ccccc1Cl)Cc1ccccc1Cl.
What is the InChIKey of 2,4,6-trimethylbenzoate;tris[(2-chlorophenyl)methyl]stannanylium?
The InChIKey is DFRVBBSCALWOGC-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H12O2.3C7H6Cl.Sn/c1-6-4-7(2)9(10(11)12)8(3)5-6;3*1-6-4-2-3-5-7(6)8;/h4-5H,1-3H3,(H,11,12);3*2-5H,1H2;/q;;;;+1/p-1.
What are the key properties of 2,4,6-trimethylbenzoate;tris[(2-chlorophenyl)methyl]stannanylium?
2,4,6-trimethylbenzoate;tris[(2-chlorophenyl)methyl]stannanylium has a molecular weight of 658.64 g/mol, XLogP of 7.76, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,6-trimethylbenzoate;tris[(2-chlorophenyl)methyl]stannanylium is sourced from PubChem (CID 174739646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).