About trifluoromethyl 3-pyrazin-2-ylpropanoate
trifluoromethyl 3-pyrazin-2-ylpropanoate (PubChem CID 174739672) has the molecular formula C8H7F3N2O2
and a molecular weight of 220.15 g/mol. Its IUPAC name is trifluoromethyl 3-pyrazin-2-ylpropanoate.
Molecular Properties
| Compound Name | trifluoromethyl 3-pyrazin-2-ylpropanoate |
| PubChem CID | 174739672 |
| Molecular Formula | C8H7F3N2O2 |
| Molecular Weight | 220.15 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | trifluoromethyl 3-pyrazin-2-ylpropanoate |
| SMILES | O=C(CCc1cnccn1)OC(F)(F)F |
| InChI | InChI=1S/C8H7F3N2O2/c9-8(10,11)15-7(14)2-1-6-5-12-3-4-13-6/h3-5H,1-2H2 |
| InChIKey | JVQGYDPSZQTDSU-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.15 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze trifluoromethyl 3-pyrazin-2-ylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trifluoromethyl 3-pyrazin-2-ylpropanoate?
The IUPAC name of trifluoromethyl 3-pyrazin-2-ylpropanoate (CID 174739672) is trifluoromethyl 3-pyrazin-2-ylpropanoate.
What is the SMILES notation for trifluoromethyl 3-pyrazin-2-ylpropanoate?
The canonical SMILES for trifluoromethyl 3-pyrazin-2-ylpropanoate is O=C(CCc1cnccn1)OC(F)(F)F.
What is the InChIKey of trifluoromethyl 3-pyrazin-2-ylpropanoate?
The InChIKey is JVQGYDPSZQTDSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F3N2O2/c9-8(10,11)15-7(14)2-1-6-5-12-3-4-13-6/h3-5H,1-2H2.
What are the key properties of trifluoromethyl 3-pyrazin-2-ylpropanoate?
trifluoromethyl 3-pyrazin-2-ylpropanoate has a molecular weight of 220.15 g/mol, XLogP of 1.47, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trifluoromethyl 3-pyrazin-2-ylpropanoate is sourced from PubChem (CID 174739672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).