C24H28N2O5S2 — CID 174740149
methanesulfonic acid;1-[[4-[5-(4-propan-2-ylphenyl)-1,3-thiazol-2-yl]phenyl]methyl]azetidine-3-carboxylic acid (PubChem CID 174740149) has the molecular formula C24H28N2O5S2 and a molecular weight of 488.63 g/mol. Its IUPAC name is methanesulfonic acid;1-[[4-[5-(4-propan-2-ylphenyl)-1,3-thiazol-2-yl]phenyl]methyl]azetidine-3-carboxylic acid.
| Compound Name | methanesulfonic acid;1-[[4-[5-(4-propan-2-ylphenyl)-1,3-thiazol-2-yl]phenyl]methyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 174740149 |
| Molecular Formula | C24H28N2O5S2 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | methanesulfonic acid;1-[[4-[5-(4-propan-2-ylphenyl)-1,3-thiazol-2-yl]phenyl]methyl]azetidine-3-carboxylic acid |
| SMILES | CC(C)c1ccc(-c2cnc(-c3ccc(CN4CC(C(=O)O)C4)cc3)s2)cc1.CS(=O)(=O)O |
| InChI | InChI=1S/C23H24N2O2S.CH4O3S/c1-15(2)17-7-9-18(10-8-17)21-11-24-22(28-21)19-5-3-16(4-6-19)12-25-13-20(14-25)23(26)27;1-5(2,3)4/h3-11,15,20H,12-14H2,1-2H3,(H,26,27);1H3,(H,2,3,4) |
| InChIKey | DGHNCPFOHDRCEE-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 107.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|