About 1H-pyrazol-5-yl trifluoromethyl carbonate
1H-pyrazol-5-yl trifluoromethyl carbonate (PubChem CID 174740176) has the molecular formula C5H3F3N2O3
and a molecular weight of 196.08 g/mol. Its IUPAC name is 1H-pyrazol-5-yl trifluoromethyl carbonate.
Molecular Properties
| Compound Name | 1H-pyrazol-5-yl trifluoromethyl carbonate |
| PubChem CID | 174740176 |
| Molecular Formula | C5H3F3N2O3 |
| Molecular Weight | 196.08 g/mol |
| Exact Mass | 196.01 |
| IUPAC Name | 1H-pyrazol-5-yl trifluoromethyl carbonate |
| SMILES | O=C(Oc1ccn[nH]1)OC(F)(F)F |
| InChI | InChI=1S/C5H3F3N2O3/c6-5(7,8)13-4(11)12-3-1-2-9-10-3/h1-2H,(H,9,10) |
| InChIKey | DHPPDYCALFTVMO-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.08 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1H-pyrazol-5-yl trifluoromethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrazol-5-yl trifluoromethyl carbonate?
The IUPAC name of 1H-pyrazol-5-yl trifluoromethyl carbonate (CID 174740176) is 1H-pyrazol-5-yl trifluoromethyl carbonate.
What is the SMILES notation for 1H-pyrazol-5-yl trifluoromethyl carbonate?
The canonical SMILES for 1H-pyrazol-5-yl trifluoromethyl carbonate is O=C(Oc1ccn[nH]1)OC(F)(F)F.
What is the InChIKey of 1H-pyrazol-5-yl trifluoromethyl carbonate?
The InChIKey is DHPPDYCALFTVMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3F3N2O3/c6-5(7,8)13-4(11)12-3-1-2-9-10-3/h1-2H,(H,9,10).
What are the key properties of 1H-pyrazol-5-yl trifluoromethyl carbonate?
1H-pyrazol-5-yl trifluoromethyl carbonate has a molecular weight of 196.08 g/mol, XLogP of 1.44, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrazol-5-yl trifluoromethyl carbonate is sourced from PubChem (CID 174740176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).