C28H48FeP2-6 — CID 174740480
[1-tert-butyl-2,2-dimethyl-1-[5-(2,2,4,4-tetramethyl-3-phosphanylpentan-3-yl)cyclopenta-1,3-dien-1-yl]propyl]phosphane;cyclopentane;iron (PubChem CID 174740480) has the molecular formula C28H48FeP2-6 and a molecular weight of 502.49 g/mol. Its IUPAC name is [1-tert-butyl-2,2-dimethyl-1-[5-(2,2,4,4-tetramethyl-3-phosphanylpentan-3-yl)cyclopenta-1,3-dien-1-yl]propyl]phosphane;cyclopentane;iron.
| Compound Name | [1-tert-butyl-2,2-dimethyl-1-[5-(2,2,4,4-tetramethyl-3-phosphanylpentan-3-yl)cyclopenta-1,3-dien-1-yl]propyl]phosphane;cyclopentane;iron |
|---|---|
| PubChem CID | 174740480 |
| Molecular Formula | C28H48FeP2-6 |
| Molecular Weight | 502.49 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | [1-tert-butyl-2,2-dimethyl-1-[5-(2,2,4,4-tetramethyl-3-phosphanylpentan-3-yl)cyclopenta-1,3-dien-1-yl]propyl]phosphane;cyclopentane;iron |
| SMILES | CC(C)(C)C(P)(c1ccc[c-]1C(P)(C(C)(C)C)C(C)(C)C)C(C)(C)C.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C23H43P2.C5H5.Fe/c1-18(2,3)22(24,19(4,5)6)16-14-13-15-17(16)23(25,20(7,8)9)21(10,11)12;1-2-4-5-3-1;/h13-15H,24-25H2,1-12H3;1-5H;/q-1;-5; |
| InChIKey | ZFMWQCITFDTXPN-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.49 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|