About 3-[2-(3,5-dimethylphenyl)ethenyl]-2,3-dihydroisoindol-1-one
3-[2-(3,5-dimethylphenyl)ethenyl]-2,3-dihydroisoindol-1-one (PubChem CID 174740484) has the molecular formula C18H17NO
and a molecular weight of 263.34 g/mol. Its IUPAC name is 3-[2-(3,5-dimethylphenyl)ethenyl]-2,3-dihydroisoindol-1-one.
Molecular Properties
| Compound Name | 3-[2-(3,5-dimethylphenyl)ethenyl]-2,3-dihydroisoindol-1-one |
| PubChem CID | 174740484 |
| Molecular Formula | C18H17NO |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 3-[2-(3,5-dimethylphenyl)ethenyl]-2,3-dihydroisoindol-1-one |
| SMILES | Cc1cc(C)cc(C=CC2NC(=O)c3ccccc32)c1 |
| InChI | InChI=1S/C18H17NO/c1-12-9-13(2)11-14(10-12)7-8-17-15-5-3-4-6-16(15)18(20)19-17/h3-11,17H,1-2H3,(H,19,20) |
| InChIKey | VHVFXAQVMXEPRY-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-[2-(3,5-dimethylphenyl)ethenyl]-2,3-dihydroisoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(3,5-dimethylphenyl)ethenyl]-2,3-dihydroisoindol-1-one?
The IUPAC name of 3-[2-(3,5-dimethylphenyl)ethenyl]-2,3-dihydroisoindol-1-one (CID 174740484) is 3-[2-(3,5-dimethylphenyl)ethenyl]-2,3-dihydroisoindol-1-one.
What is the SMILES notation for 3-[2-(3,5-dimethylphenyl)ethenyl]-2,3-dihydroisoindol-1-one?
The canonical SMILES for 3-[2-(3,5-dimethylphenyl)ethenyl]-2,3-dihydroisoindol-1-one is Cc1cc(C)cc(C=CC2NC(=O)c3ccccc32)c1.
What is the InChIKey of 3-[2-(3,5-dimethylphenyl)ethenyl]-2,3-dihydroisoindol-1-one?
The InChIKey is VHVFXAQVMXEPRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17NO/c1-12-9-13(2)11-14(10-12)7-8-17-15-5-3-4-6-16(15)18(20)19-17/h3-11,17H,1-2H3,(H,19,20).
What are the key properties of 3-[2-(3,5-dimethylphenyl)ethenyl]-2,3-dihydroisoindol-1-one?
3-[2-(3,5-dimethylphenyl)ethenyl]-2,3-dihydroisoindol-1-one has a molecular weight of 263.34 g/mol, XLogP of 3.80, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(3,5-dimethylphenyl)ethenyl]-2,3-dihydroisoindol-1-one is sourced from PubChem (CID 174740484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).