About indolizin-1-yl 3-(1H-indol-5-yl)-3-oxopropanoate
indolizin-1-yl 3-(1H-indol-5-yl)-3-oxopropanoate (PubChem CID 174741309) has the molecular formula C19H14N2O3
and a molecular weight of 318.33 g/mol. Its IUPAC name is indolizin-1-yl 3-(1H-indol-5-yl)-3-oxopropanoate.
Molecular Properties
| Compound Name | indolizin-1-yl 3-(1H-indol-5-yl)-3-oxopropanoate |
| PubChem CID | 174741309 |
| Molecular Formula | C19H14N2O3 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | indolizin-1-yl 3-(1H-indol-5-yl)-3-oxopropanoate |
| SMILES | O=C(CC(=O)c1ccc2[nH]ccc2c1)Oc1ccn2ccccc12 |
| InChI | InChI=1S/C19H14N2O3/c22-17(14-4-5-15-13(11-14)6-8-20-15)12-19(23)24-18-7-10-21-9-2-1-3-16(18)21/h1-11,20H,12H2 |
| InChIKey | YDJLMCXUKRJZOE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze indolizin-1-yl 3-(1H-indol-5-yl)-3-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of indolizin-1-yl 3-(1H-indol-5-yl)-3-oxopropanoate?
The IUPAC name of indolizin-1-yl 3-(1H-indol-5-yl)-3-oxopropanoate (CID 174741309) is indolizin-1-yl 3-(1H-indol-5-yl)-3-oxopropanoate.
What is the SMILES notation for indolizin-1-yl 3-(1H-indol-5-yl)-3-oxopropanoate?
The canonical SMILES for indolizin-1-yl 3-(1H-indol-5-yl)-3-oxopropanoate is O=C(CC(=O)c1ccc2[nH]ccc2c1)Oc1ccn2ccccc12.
What is the InChIKey of indolizin-1-yl 3-(1H-indol-5-yl)-3-oxopropanoate?
The InChIKey is YDJLMCXUKRJZOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14N2O3/c22-17(14-4-5-15-13(11-14)6-8-20-15)12-19(23)24-18-7-10-21-9-2-1-3-16(18)21/h1-11,20H,12H2.
What are the key properties of indolizin-1-yl 3-(1H-indol-5-yl)-3-oxopropanoate?
indolizin-1-yl 3-(1H-indol-5-yl)-3-oxopropanoate has a molecular weight of 318.33 g/mol, XLogP of 3.60, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for indolizin-1-yl 3-(1H-indol-5-yl)-3-oxopropanoate is sourced from PubChem (CID 174741309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).