C4H10N8O4S — CID 174741356
[(4,6-diamino-1,3,5-triazin-2-yl)amino] hydrogen sulfate;methanimidamide (PubChem CID 174741356) has the molecular formula C4H10N8O4S and a molecular weight of 266.24 g/mol. Its IUPAC name is [(4,6-diamino-1,3,5-triazin-2-yl)amino] hydrogen sulfate;methanimidamide.
| Compound Name | [(4,6-diamino-1,3,5-triazin-2-yl)amino] hydrogen sulfate;methanimidamide |
|---|---|
| PubChem CID | 174741356 |
| Molecular Formula | C4H10N8O4S |
| Molecular Weight | 266.24 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | [(4,6-diamino-1,3,5-triazin-2-yl)amino] hydrogen sulfate;methanimidamide |
| SMILES | Nc1nc(N)nc(NOS(=O)(=O)O)n1.[H]/N=C/N |
| InChI | InChI=1S/C3H6N6O4S.CH4N2/c4-1-6-2(5)8-3(7-1)9-13-14(10,11)12;2-1-3/h(H,10,11,12)(H5,4,5,6,7,8,9);1H,(H3,2,3) |
| InChIKey | ACBMZAVWSRXCJI-UHFFFAOYSA-N |
| XLogP | -2.27 |
| TPSA | 216.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.24 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|