About 3-(dimethylamino)-3-methyl-1,4-diphenylbutan-1-one;morpholine
3-(dimethylamino)-3-methyl-1,4-diphenylbutan-1-one;morpholine (PubChem CID 174741727) has the molecular formula C23H32N2O2
and a molecular weight of 368.52 g/mol. Its IUPAC name is 3-(dimethylamino)-3-methyl-1,4-diphenylbutan-1-one;morpholine.
Molecular Properties
| Compound Name | 3-(dimethylamino)-3-methyl-1,4-diphenylbutan-1-one;morpholine |
| PubChem CID | 174741727 |
| Molecular Formula | C23H32N2O2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | 3-(dimethylamino)-3-methyl-1,4-diphenylbutan-1-one;morpholine |
| SMILES | C1COCCN1.CN(C)C(C)(CC(=O)c1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C19H23NO.C4H9NO/c1-19(20(2)3,14-16-10-6-4-7-11-16)15-18(21)17-12-8-5-9-13-17;1-3-6-4-2-5-1/h4-13H,14-15H2,1-3H3;5H,1-4H2 |
| InChIKey | JRMRAWDFAQGPGU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(dimethylamino)-3-methyl-1,4-diphenylbutan-1-one;morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dimethylamino)-3-methyl-1,4-diphenylbutan-1-one;morpholine?
The IUPAC name of 3-(dimethylamino)-3-methyl-1,4-diphenylbutan-1-one;morpholine (CID 174741727) is 3-(dimethylamino)-3-methyl-1,4-diphenylbutan-1-one;morpholine.
What is the SMILES notation for 3-(dimethylamino)-3-methyl-1,4-diphenylbutan-1-one;morpholine?
The canonical SMILES for 3-(dimethylamino)-3-methyl-1,4-diphenylbutan-1-one;morpholine is C1COCCN1.CN(C)C(C)(CC(=O)c1ccccc1)Cc1ccccc1.
What is the InChIKey of 3-(dimethylamino)-3-methyl-1,4-diphenylbutan-1-one;morpholine?
The InChIKey is JRMRAWDFAQGPGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23NO.C4H9NO/c1-19(20(2)3,14-16-10-6-4-7-11-16)15-18(21)17-12-8-5-9-13-17;1-3-6-4-2-5-1/h4-13H,14-15H2,1-3H3;5H,1-4H2.
What are the key properties of 3-(dimethylamino)-3-methyl-1,4-diphenylbutan-1-one;morpholine?
3-(dimethylamino)-3-methyl-1,4-diphenylbutan-1-one;morpholine has a molecular weight of 368.52 g/mol, XLogP of 3.43, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dimethylamino)-3-methyl-1,4-diphenylbutan-1-one;morpholine is sourced from PubChem (CID 174741727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).