About N-[2,4-dimethyl-6-(trifluoromethyl)pyrimidin-5-yl]formamide
N-[2,4-dimethyl-6-(trifluoromethyl)pyrimidin-5-yl]formamide (PubChem CID 174741917) has the molecular formula C8H8F3N3O
and a molecular weight of 219.17 g/mol. Its IUPAC name is N-[2,4-dimethyl-6-(trifluoromethyl)pyrimidin-5-yl]formamide.
Molecular Properties
| Compound Name | N-[2,4-dimethyl-6-(trifluoromethyl)pyrimidin-5-yl]formamide |
| PubChem CID | 174741917 |
| Molecular Formula | C8H8F3N3O |
| Molecular Weight | 219.17 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | N-[2,4-dimethyl-6-(trifluoromethyl)pyrimidin-5-yl]formamide |
| SMILES | Cc1nc(C)c(NC=O)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C8H8F3N3O/c1-4-6(12-3-15)7(8(9,10)11)14-5(2)13-4/h3H,1-2H3,(H,12,15) |
| InChIKey | AFDSXZYTNGELHJ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.17 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[2,4-dimethyl-6-(trifluoromethyl)pyrimidin-5-yl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,4-dimethyl-6-(trifluoromethyl)pyrimidin-5-yl]formamide?
The IUPAC name of N-[2,4-dimethyl-6-(trifluoromethyl)pyrimidin-5-yl]formamide (CID 174741917) is N-[2,4-dimethyl-6-(trifluoromethyl)pyrimidin-5-yl]formamide.
What is the SMILES notation for N-[2,4-dimethyl-6-(trifluoromethyl)pyrimidin-5-yl]formamide?
The canonical SMILES for N-[2,4-dimethyl-6-(trifluoromethyl)pyrimidin-5-yl]formamide is Cc1nc(C)c(NC=O)c(C(F)(F)F)n1.
What is the InChIKey of N-[2,4-dimethyl-6-(trifluoromethyl)pyrimidin-5-yl]formamide?
The InChIKey is AFDSXZYTNGELHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F3N3O/c1-4-6(12-3-15)7(8(9,10)11)14-5(2)13-4/h3H,1-2H3,(H,12,15).
What are the key properties of N-[2,4-dimethyl-6-(trifluoromethyl)pyrimidin-5-yl]formamide?
N-[2,4-dimethyl-6-(trifluoromethyl)pyrimidin-5-yl]formamide has a molecular weight of 219.17 g/mol, XLogP of 1.68, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,4-dimethyl-6-(trifluoromethyl)pyrimidin-5-yl]formamide is sourced from PubChem (CID 174741917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).