C7H17N7 — CID 174741943
4,6-bis(2-aminoethyl)-2H-1,3,5-triazine-1,2-diamine (PubChem CID 174741943) has the molecular formula C7H17N7 and a molecular weight of 199.26 g/mol. Its IUPAC name is 4,6-bis(2-aminoethyl)-2H-1,3,5-triazine-1,2-diamine.
| Compound Name | 4,6-bis(2-aminoethyl)-2H-1,3,5-triazine-1,2-diamine |
|---|---|
| PubChem CID | 174741943 |
| Molecular Formula | C7H17N7 |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 199.15 |
| IUPAC Name | 4,6-bis(2-aminoethyl)-2H-1,3,5-triazine-1,2-diamine |
| SMILES | NCCC1=NC(N)N(N)C(CCN)=N1 |
| InChI | InChI=1S/C7H17N7/c8-3-1-5-12-6(2-4-9)14(11)7(10)13-5/h7H,1-4,8-11H2 |
| InChIKey | DPLBCTLVZJZXRM-UHFFFAOYSA-N |
| XLogP | -2.09 |
| TPSA | 132.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|