C15H12F3NO3 — CID 174742182
2-[5-[2-oxo-2-[4-(trifluoromethyl)phenyl]ethyl]-1H-pyrrol-2-yl]acetic acid (PubChem CID 174742182) has the molecular formula C15H12F3NO3 and a molecular weight of 311.26 g/mol. Its IUPAC name is 2-[5-[2-oxo-2-[4-(trifluoromethyl)phenyl]ethyl]-1H-pyrrol-2-yl]acetic acid.
| Compound Name | 2-[5-[2-oxo-2-[4-(trifluoromethyl)phenyl]ethyl]-1H-pyrrol-2-yl]acetic acid |
|---|---|
| PubChem CID | 174742182 |
| Molecular Formula | C15H12F3NO3 |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 2-[5-[2-oxo-2-[4-(trifluoromethyl)phenyl]ethyl]-1H-pyrrol-2-yl]acetic acid |
| SMILES | O=C(O)Cc1ccc(CC(=O)c2ccc(C(F)(F)F)cc2)[nH]1 |
| InChI | InChI=1S/C15H12F3NO3/c16-15(17,18)10-3-1-9(2-4-10)13(20)7-11-5-6-12(19-11)8-14(21)22/h1-6,19H,7-8H2,(H,21,22) |
| InChIKey | BZPQQLNEIJDKGJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |