About azane;3,3-dimethyl-1-(2-phenylcyclopropyl)piperidine
azane;3,3-dimethyl-1-(2-phenylcyclopropyl)piperidine (PubChem CID 174742418) has the molecular formula C16H26N2
and a molecular weight of 246.40 g/mol. Its IUPAC name is azane;3,3-dimethyl-1-(2-phenylcyclopropyl)piperidine.
Molecular Properties
| Compound Name | azane;3,3-dimethyl-1-(2-phenylcyclopropyl)piperidine |
| PubChem CID | 174742418 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | azane;3,3-dimethyl-1-(2-phenylcyclopropyl)piperidine |
| SMILES | CC1(C)CCCN(C2CC2c2ccccc2)C1.N |
| InChI | InChI=1S/C16H23N.H3N/c1-16(2)9-6-10-17(12-16)15-11-14(15)13-7-4-3-5-8-13;/h3-5,7-8,14-15H,6,9-12H2,1-2H3;1H3 |
| InChIKey | WQKUKBGQSHNWBX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 38.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azane;3,3-dimethyl-1-(2-phenylcyclopropyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;3,3-dimethyl-1-(2-phenylcyclopropyl)piperidine?
The IUPAC name of azane;3,3-dimethyl-1-(2-phenylcyclopropyl)piperidine (CID 174742418) is azane;3,3-dimethyl-1-(2-phenylcyclopropyl)piperidine.
What is the SMILES notation for azane;3,3-dimethyl-1-(2-phenylcyclopropyl)piperidine?
The canonical SMILES for azane;3,3-dimethyl-1-(2-phenylcyclopropyl)piperidine is CC1(C)CCCN(C2CC2c2ccccc2)C1.N.
What is the InChIKey of azane;3,3-dimethyl-1-(2-phenylcyclopropyl)piperidine?
The InChIKey is WQKUKBGQSHNWBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N.H3N/c1-16(2)9-6-10-17(12-16)15-11-14(15)13-7-4-3-5-8-13;/h3-5,7-8,14-15H,6,9-12H2,1-2H3;1H3.
What are the key properties of azane;3,3-dimethyl-1-(2-phenylcyclopropyl)piperidine?
azane;3,3-dimethyl-1-(2-phenylcyclopropyl)piperidine has a molecular weight of 246.40 g/mol, XLogP of 3.83, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;3,3-dimethyl-1-(2-phenylcyclopropyl)piperidine is sourced from PubChem (CID 174742418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).