About 7-oxabicyclo[4.1.0]hept-1-ene-3,4-dicarboxylic acid;2-(oxiran-2-ylmethoxymethyl)oxirane
7-oxabicyclo[4.1.0]hept-1-ene-3,4-dicarboxylic acid;2-(oxiran-2-ylmethoxymethyl)oxirane (PubChem CID 174742819) has the molecular formula C14H18O8
and a molecular weight of 314.29 g/mol. Its IUPAC name is 7-oxabicyclo[4.1.0]hept-1-ene-3,4-dicarboxylic acid;2-(oxiran-2-ylmethoxymethyl)oxirane.
Molecular Properties
| Compound Name | 7-oxabicyclo[4.1.0]hept-1-ene-3,4-dicarboxylic acid;2-(oxiran-2-ylmethoxymethyl)oxirane |
| PubChem CID | 174742819 |
| Molecular Formula | C14H18O8 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 7-oxabicyclo[4.1.0]hept-1-ene-3,4-dicarboxylic acid;2-(oxiran-2-ylmethoxymethyl)oxirane |
| SMILES | C(OCC1CO1)C1CO1.O=C(O)C1C=C2OC2CC1C(=O)O |
| InChI | InChI=1S/C8H8O5.C6H10O3/c9-7(10)3-1-5-6(13-5)2-4(3)8(11)12;1(5-3-8-5)7-2-6-4-9-6/h1,3-4,6H,2H2,(H,9,10)(H,11,12);5-6H,1-4H2 |
| InChIKey | DTEKCCCEVNVAHV-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 121.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 7-oxabicyclo[4.1.0]hept-1-ene-3,4-dicarboxylic acid;2-(oxiran-2-ylmethoxymethyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-oxabicyclo[4.1.0]hept-1-ene-3,4-dicarboxylic acid;2-(oxiran-2-ylmethoxymethyl)oxirane?
The IUPAC name of 7-oxabicyclo[4.1.0]hept-1-ene-3,4-dicarboxylic acid;2-(oxiran-2-ylmethoxymethyl)oxirane (CID 174742819) is 7-oxabicyclo[4.1.0]hept-1-ene-3,4-dicarboxylic acid;2-(oxiran-2-ylmethoxymethyl)oxirane.
What is the SMILES notation for 7-oxabicyclo[4.1.0]hept-1-ene-3,4-dicarboxylic acid;2-(oxiran-2-ylmethoxymethyl)oxirane?
The canonical SMILES for 7-oxabicyclo[4.1.0]hept-1-ene-3,4-dicarboxylic acid;2-(oxiran-2-ylmethoxymethyl)oxirane is C(OCC1CO1)C1CO1.O=C(O)C1C=C2OC2CC1C(=O)O.
What is the InChIKey of 7-oxabicyclo[4.1.0]hept-1-ene-3,4-dicarboxylic acid;2-(oxiran-2-ylmethoxymethyl)oxirane?
The InChIKey is DTEKCCCEVNVAHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O5.C6H10O3/c9-7(10)3-1-5-6(13-5)2-4(3)8(11)12;1(5-3-8-5)7-2-6-4-9-6/h1,3-4,6H,2H2,(H,9,10)(H,11,12);5-6H,1-4H2.
What are the key properties of 7-oxabicyclo[4.1.0]hept-1-ene-3,4-dicarboxylic acid;2-(oxiran-2-ylmethoxymethyl)oxirane?
7-oxabicyclo[4.1.0]hept-1-ene-3,4-dicarboxylic acid;2-(oxiran-2-ylmethoxymethyl)oxirane has a molecular weight of 314.29 g/mol, XLogP of -0.12, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-oxabicyclo[4.1.0]hept-1-ene-3,4-dicarboxylic acid;2-(oxiran-2-ylmethoxymethyl)oxirane is sourced from PubChem (CID 174742819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).