About 2-methylpropanedioyl dichloride;dihydrochloride
2-methylpropanedioyl dichloride;dihydrochloride (PubChem CID 174742861) has the molecular formula C4H6Cl4O2
and a molecular weight of 227.90 g/mol. Its IUPAC name is 2-methylpropanedioyl dichloride;dihydrochloride.
Molecular Properties
| Compound Name | 2-methylpropanedioyl dichloride;dihydrochloride |
| PubChem CID | 174742861 |
| Molecular Formula | C4H6Cl4O2 |
| Molecular Weight | 227.90 g/mol |
| Exact Mass | 225.91 |
| IUPAC Name | 2-methylpropanedioyl dichloride;dihydrochloride |
| SMILES | CC(C(=O)Cl)C(=O)Cl.Cl.Cl |
| InChI | InChI=1S/C4H4Cl2O2.2ClH/c1-2(3(5)7)4(6)8;;/h2H,1H3;2*1H |
| InChIKey | JHNXBZCTTMKHHX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.90 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropanedioyl dichloride;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropanedioyl dichloride;dihydrochloride?
The IUPAC name of 2-methylpropanedioyl dichloride;dihydrochloride (CID 174742861) is 2-methylpropanedioyl dichloride;dihydrochloride.
What is the SMILES notation for 2-methylpropanedioyl dichloride;dihydrochloride?
The canonical SMILES for 2-methylpropanedioyl dichloride;dihydrochloride is CC(C(=O)Cl)C(=O)Cl.Cl.Cl.
What is the InChIKey of 2-methylpropanedioyl dichloride;dihydrochloride?
The InChIKey is JHNXBZCTTMKHHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4Cl2O2.2ClH/c1-2(3(5)7)4(6)8;;/h2H,1H3;2*1H.
What are the key properties of 2-methylpropanedioyl dichloride;dihydrochloride?
2-methylpropanedioyl dichloride;dihydrochloride has a molecular weight of 227.90 g/mol, XLogP of 2.00, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropanedioyl dichloride;dihydrochloride is sourced from PubChem (CID 174742861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).