C16H13FN2OS — CID 17474302
N-[1-(4-fluorophenyl)ethyl]-1,3-benzothiazole-6-carboxamide (PubChem CID 17474302) has the molecular formula C16H13FN2OS and a molecular weight of 300.36 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)ethyl]-1,3-benzothiazole-6-carboxamide.
| Compound Name | N-[1-(4-fluorophenyl)ethyl]-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 17474302 |
| Molecular Formula | C16H13FN2OS |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | N-[1-(4-fluorophenyl)ethyl]-1,3-benzothiazole-6-carboxamide |
| SMILES | CC(NC(=O)c1ccc2ncsc2c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H13FN2OS/c1-10(11-2-5-13(17)6-3-11)19-16(20)12-4-7-14-15(8-12)21-9-18-14/h2-10H,1H3,(H,19,20) |
| InChIKey | QVMTZGMBBNAOJM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |