About 1,1-bis(4,4-dimethoxy-1-silylpentyl)urea
1,1-bis(4,4-dimethoxy-1-silylpentyl)urea (PubChem CID 174743039) has the molecular formula C15H36N2O5Si2
and a molecular weight of 380.63 g/mol. Its IUPAC name is 1,1-bis(4,4-dimethoxy-1-silylpentyl)urea.
Molecular Properties
| Compound Name | 1,1-bis(4,4-dimethoxy-1-silylpentyl)urea |
| PubChem CID | 174743039 |
| Molecular Formula | C15H36N2O5Si2 |
| Molecular Weight | 380.63 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 1,1-bis(4,4-dimethoxy-1-silylpentyl)urea |
| SMILES | COC(C)(CCC([SiH3])N(C(N)=O)C([SiH3])CCC(C)(OC)OC)OC |
| InChI | InChI=1S/C15H36N2O5Si2/c1-14(19-3,20-4)9-7-11(23)17(13(16)18)12(24)8-10-15(2,21-5)22-6/h11-12H,7-10H2,1-6,23-24H3,(H2,16,18) |
| InChIKey | HBWMIFMZKNULSU-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 83.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.63 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,1-bis(4,4-dimethoxy-1-silylpentyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-bis(4,4-dimethoxy-1-silylpentyl)urea?
The IUPAC name of 1,1-bis(4,4-dimethoxy-1-silylpentyl)urea (CID 174743039) is 1,1-bis(4,4-dimethoxy-1-silylpentyl)urea.
What is the SMILES notation for 1,1-bis(4,4-dimethoxy-1-silylpentyl)urea?
The canonical SMILES for 1,1-bis(4,4-dimethoxy-1-silylpentyl)urea is COC(C)(CCC([SiH3])N(C(N)=O)C([SiH3])CCC(C)(OC)OC)OC.
What is the InChIKey of 1,1-bis(4,4-dimethoxy-1-silylpentyl)urea?
The InChIKey is HBWMIFMZKNULSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H36N2O5Si2/c1-14(19-3,20-4)9-7-11(23)17(13(16)18)12(24)8-10-15(2,21-5)22-6/h11-12H,7-10H2,1-6,23-24H3,(H2,16,18).
What are the key properties of 1,1-bis(4,4-dimethoxy-1-silylpentyl)urea?
1,1-bis(4,4-dimethoxy-1-silylpentyl)urea has a molecular weight of 380.63 g/mol, XLogP of -0.67, 12 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-bis(4,4-dimethoxy-1-silylpentyl)urea is sourced from PubChem (CID 174743039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).