About 1-chloro-4-isocyanatobenzene;isocyanic acid
1-chloro-4-isocyanatobenzene;isocyanic acid (PubChem CID 174743412) has the molecular formula C8H5ClN2O2
and a molecular weight of 196.59 g/mol. Its IUPAC name is 1-chloro-4-isocyanatobenzene;isocyanic acid.
Molecular Properties
| Compound Name | 1-chloro-4-isocyanatobenzene;isocyanic acid |
| PubChem CID | 174743412 |
| Molecular Formula | C8H5ClN2O2 |
| Molecular Weight | 196.59 g/mol |
| Exact Mass | 196.00 |
| IUPAC Name | 1-chloro-4-isocyanatobenzene;isocyanic acid |
| SMILES | N=C=O.O=C=Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C7H4ClNO.CHNO/c8-6-1-3-7(4-2-6)9-5-10;2-1-3/h1-4H;2H |
| InChIKey | OIAUVHRWUZOZPH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 70.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.59 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-4-isocyanatobenzene;isocyanic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-isocyanatobenzene;isocyanic acid?
The IUPAC name of 1-chloro-4-isocyanatobenzene;isocyanic acid (CID 174743412) is 1-chloro-4-isocyanatobenzene;isocyanic acid.
What is the SMILES notation for 1-chloro-4-isocyanatobenzene;isocyanic acid?
The canonical SMILES for 1-chloro-4-isocyanatobenzene;isocyanic acid is N=C=O.O=C=Nc1ccc(Cl)cc1.
What is the InChIKey of 1-chloro-4-isocyanatobenzene;isocyanic acid?
The InChIKey is OIAUVHRWUZOZPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4ClNO.CHNO/c8-6-1-3-7(4-2-6)9-5-10;2-1-3/h1-4H;2H.
What are the key properties of 1-chloro-4-isocyanatobenzene;isocyanic acid?
1-chloro-4-isocyanatobenzene;isocyanic acid has a molecular weight of 196.59 g/mol, XLogP of 2.21, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-isocyanatobenzene;isocyanic acid is sourced from PubChem (CID 174743412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).