About 6-fluoro-4-phenyl-6-propoxycyclohexa-1,3-dien-1-amine
6-fluoro-4-phenyl-6-propoxycyclohexa-1,3-dien-1-amine (PubChem CID 174743511) has the molecular formula C15H18FNO
and a molecular weight of 247.31 g/mol. Its IUPAC name is 6-fluoro-4-phenyl-6-propoxycyclohexa-1,3-dien-1-amine.
Molecular Properties
| Compound Name | 6-fluoro-4-phenyl-6-propoxycyclohexa-1,3-dien-1-amine |
| PubChem CID | 174743511 |
| Molecular Formula | C15H18FNO |
| Molecular Weight | 247.31 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 6-fluoro-4-phenyl-6-propoxycyclohexa-1,3-dien-1-amine |
| SMILES | CCCOC1(F)CC(c2ccccc2)=CC=C1N |
| InChI | InChI=1S/C15H18FNO/c1-2-10-18-15(16)11-13(8-9-14(15)17)12-6-4-3-5-7-12/h3-9H,2,10-11,17H2,1H3 |
| InChIKey | PAZRRMLSQUCLSP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.31 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-fluoro-4-phenyl-6-propoxycyclohexa-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-4-phenyl-6-propoxycyclohexa-1,3-dien-1-amine?
The IUPAC name of 6-fluoro-4-phenyl-6-propoxycyclohexa-1,3-dien-1-amine (CID 174743511) is 6-fluoro-4-phenyl-6-propoxycyclohexa-1,3-dien-1-amine.
What is the SMILES notation for 6-fluoro-4-phenyl-6-propoxycyclohexa-1,3-dien-1-amine?
The canonical SMILES for 6-fluoro-4-phenyl-6-propoxycyclohexa-1,3-dien-1-amine is CCCOC1(F)CC(c2ccccc2)=CC=C1N.
What is the InChIKey of 6-fluoro-4-phenyl-6-propoxycyclohexa-1,3-dien-1-amine?
The InChIKey is PAZRRMLSQUCLSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18FNO/c1-2-10-18-15(16)11-13(8-9-14(15)17)12-6-4-3-5-7-12/h3-9H,2,10-11,17H2,1H3.
What are the key properties of 6-fluoro-4-phenyl-6-propoxycyclohexa-1,3-dien-1-amine?
6-fluoro-4-phenyl-6-propoxycyclohexa-1,3-dien-1-amine has a molecular weight of 247.31 g/mol, XLogP of 3.41, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-4-phenyl-6-propoxycyclohexa-1,3-dien-1-amine is sourced from PubChem (CID 174743511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).