About 4-benzyl-2-methylbenzene-1,3-dicarboxylic acid;1-methylpiperazine
4-benzyl-2-methylbenzene-1,3-dicarboxylic acid;1-methylpiperazine (PubChem CID 174743515) has the molecular formula C21H26N2O4
and a molecular weight of 370.45 g/mol. Its IUPAC name is 4-benzyl-2-methylbenzene-1,3-dicarboxylic acid;1-methylpiperazine.
Molecular Properties
| Compound Name | 4-benzyl-2-methylbenzene-1,3-dicarboxylic acid;1-methylpiperazine |
| PubChem CID | 174743515 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 4-benzyl-2-methylbenzene-1,3-dicarboxylic acid;1-methylpiperazine |
| SMILES | CN1CCNCC1.Cc1c(C(=O)O)ccc(Cc2ccccc2)c1C(=O)O |
| InChI | InChI=1S/C16H14O4.C5H12N2/c1-10-13(15(17)18)8-7-12(14(10)16(19)20)9-11-5-3-2-4-6-11;1-7-4-2-6-3-5-7/h2-8H,9H2,1H3,(H,17,18)(H,19,20);6H,2-5H2,1H3 |
| InChIKey | TWIDGHVSVXPEQB-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-benzyl-2-methylbenzene-1,3-dicarboxylic acid;1-methylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-2-methylbenzene-1,3-dicarboxylic acid;1-methylpiperazine?
The IUPAC name of 4-benzyl-2-methylbenzene-1,3-dicarboxylic acid;1-methylpiperazine (CID 174743515) is 4-benzyl-2-methylbenzene-1,3-dicarboxylic acid;1-methylpiperazine.
What is the SMILES notation for 4-benzyl-2-methylbenzene-1,3-dicarboxylic acid;1-methylpiperazine?
The canonical SMILES for 4-benzyl-2-methylbenzene-1,3-dicarboxylic acid;1-methylpiperazine is CN1CCNCC1.Cc1c(C(=O)O)ccc(Cc2ccccc2)c1C(=O)O.
What is the InChIKey of 4-benzyl-2-methylbenzene-1,3-dicarboxylic acid;1-methylpiperazine?
The InChIKey is TWIDGHVSVXPEQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O4.C5H12N2/c1-10-13(15(17)18)8-7-12(14(10)16(19)20)9-11-5-3-2-4-6-11;1-7-4-2-6-3-5-7/h2-8H,9H2,1H3,(H,17,18)(H,19,20);6H,2-5H2,1H3.
What are the key properties of 4-benzyl-2-methylbenzene-1,3-dicarboxylic acid;1-methylpiperazine?
4-benzyl-2-methylbenzene-1,3-dicarboxylic acid;1-methylpiperazine has a molecular weight of 370.45 g/mol, XLogP of 2.50, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-2-methylbenzene-1,3-dicarboxylic acid;1-methylpiperazine is sourced from PubChem (CID 174743515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).