About 1-ethoxyimidazole;quinoline;hydrochloride
1-ethoxyimidazole;quinoline;hydrochloride (PubChem CID 174743695) has the molecular formula C14H16ClN3O
and a molecular weight of 277.76 g/mol. Its IUPAC name is 1-ethoxyimidazole;quinoline;hydrochloride.
Molecular Properties
| Compound Name | 1-ethoxyimidazole;quinoline;hydrochloride |
| PubChem CID | 174743695 |
| Molecular Formula | C14H16ClN3O |
| Molecular Weight | 277.76 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 1-ethoxyimidazole;quinoline;hydrochloride |
| SMILES | CCOn1ccnc1.Cl.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C5H8N2O.ClH/c1-2-6-9-8(4-1)5-3-7-10-9;1-2-8-7-4-3-6-5-7;/h1-7H;3-5H,2H2,1H3;1H |
| InChIKey | BKVPEKKPTVANSX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.76 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-ethoxyimidazole;quinoline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxyimidazole;quinoline;hydrochloride?
The IUPAC name of 1-ethoxyimidazole;quinoline;hydrochloride (CID 174743695) is 1-ethoxyimidazole;quinoline;hydrochloride.
What is the SMILES notation for 1-ethoxyimidazole;quinoline;hydrochloride?
The canonical SMILES for 1-ethoxyimidazole;quinoline;hydrochloride is CCOn1ccnc1.Cl.c1ccc2ncccc2c1.
What is the InChIKey of 1-ethoxyimidazole;quinoline;hydrochloride?
The InChIKey is BKVPEKKPTVANSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C5H8N2O.ClH/c1-2-6-9-8(4-1)5-3-7-10-9;1-2-8-7-4-3-6-5-7;/h1-7H;3-5H,2H2,1H3;1H.
What are the key properties of 1-ethoxyimidazole;quinoline;hydrochloride?
1-ethoxyimidazole;quinoline;hydrochloride has a molecular weight of 277.76 g/mol, XLogP of 2.99, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxyimidazole;quinoline;hydrochloride is sourced from PubChem (CID 174743695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).