C22H22N2O5S — CID 174743808
(4-methylphenyl)-[2-oxo-2-(4-phenylmethoxyanilino)ethyl]sulfamic acid (PubChem CID 174743808) has the molecular formula C22H22N2O5S and a molecular weight of 426.49 g/mol. Its IUPAC name is (4-methylphenyl)-[2-oxo-2-(4-phenylmethoxyanilino)ethyl]sulfamic acid.
| Compound Name | (4-methylphenyl)-[2-oxo-2-(4-phenylmethoxyanilino)ethyl]sulfamic acid |
|---|---|
| PubChem CID | 174743808 |
| Molecular Formula | C22H22N2O5S |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | (4-methylphenyl)-[2-oxo-2-(4-phenylmethoxyanilino)ethyl]sulfamic acid |
| SMILES | Cc1ccc(N(CC(=O)Nc2ccc(OCc3ccccc3)cc2)S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C22H22N2O5S/c1-17-7-11-20(12-8-17)24(30(26,27)28)15-22(25)23-19-9-13-21(14-10-19)29-16-18-5-3-2-4-6-18/h2-14H,15-16H2,1H3,(H,23,25)(H,26,27,28) |
| InChIKey | LSHDAGJWXGAQKH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|