C23H32ClN3O5 — CID 174743869
tert-butyl 4-[4-[carbonochloridoyloxy(phenyl)methyl]piperazine-1-carbonyl]piperidine-1-carboxylate (PubChem CID 174743869) has the molecular formula C23H32ClN3O5 and a molecular weight of 465.98 g/mol. Its IUPAC name is tert-butyl 4-[4-[carbonochloridoyloxy(phenyl)methyl]piperazine-1-carbonyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[carbonochloridoyloxy(phenyl)methyl]piperazine-1-carbonyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 174743869 |
| Molecular Formula | C23H32ClN3O5 |
| Molecular Weight | 465.98 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | tert-butyl 4-[4-[carbonochloridoyloxy(phenyl)methyl]piperazine-1-carbonyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)N2CCN(C(OC(=O)Cl)c3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C23H32ClN3O5/c1-23(2,3)32-22(30)27-11-9-17(10-12-27)19(28)25-13-15-26(16-14-25)20(31-21(24)29)18-7-5-4-6-8-18/h4-8,17,20H,9-16H2,1-3H3 |
| InChIKey | XXTLLNDDCFBKNH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.98 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|