About 7,8-dimethoxy-1,2-dihydronaphthalen-2-ol
7,8-dimethoxy-1,2-dihydronaphthalen-2-ol (PubChem CID 174744187) has the molecular formula C12H14O3
and a molecular weight of 206.24 g/mol. Its IUPAC name is 7,8-dimethoxy-1,2-dihydronaphthalen-2-ol.
Molecular Properties
| Compound Name | 7,8-dimethoxy-1,2-dihydronaphthalen-2-ol |
| PubChem CID | 174744187 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 7,8-dimethoxy-1,2-dihydronaphthalen-2-ol |
| SMILES | COc1ccc2c(c1OC)CC(O)C=C2 |
| InChI | InChI=1S/C12H14O3/c1-14-11-6-4-8-3-5-9(13)7-10(8)12(11)15-2/h3-6,9,13H,7H2,1-2H3 |
| InChIKey | TUQZWHFDNHZVCM-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7,8-dimethoxy-1,2-dihydronaphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dimethoxy-1,2-dihydronaphthalen-2-ol?
The IUPAC name of 7,8-dimethoxy-1,2-dihydronaphthalen-2-ol (CID 174744187) is 7,8-dimethoxy-1,2-dihydronaphthalen-2-ol.
What is the SMILES notation for 7,8-dimethoxy-1,2-dihydronaphthalen-2-ol?
The canonical SMILES for 7,8-dimethoxy-1,2-dihydronaphthalen-2-ol is COc1ccc2c(c1OC)CC(O)C=C2.
What is the InChIKey of 7,8-dimethoxy-1,2-dihydronaphthalen-2-ol?
The InChIKey is TUQZWHFDNHZVCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O3/c1-14-11-6-4-8-3-5-9(13)7-10(8)12(11)15-2/h3-6,9,13H,7H2,1-2H3.
What are the key properties of 7,8-dimethoxy-1,2-dihydronaphthalen-2-ol?
7,8-dimethoxy-1,2-dihydronaphthalen-2-ol has a molecular weight of 206.24 g/mol, XLogP of 1.63, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dimethoxy-1,2-dihydronaphthalen-2-ol is sourced from PubChem (CID 174744187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).