About 2-azabicyclo[4.1.0]hepta-1(6),2,4-triene;formic acid
2-azabicyclo[4.1.0]hepta-1(6),2,4-triene;formic acid (PubChem CID 174744482) has the molecular formula C7H7NO2
and a molecular weight of 137.14 g/mol. Its IUPAC name is 2-azabicyclo[4.1.0]hepta-1(6),2,4-triene;formic acid.
Molecular Properties
| Compound Name | 2-azabicyclo[4.1.0]hepta-1(6),2,4-triene;formic acid |
| PubChem CID | 174744482 |
| Molecular Formula | C7H7NO2 |
| Molecular Weight | 137.14 g/mol |
| Exact Mass | 137.05 |
| IUPAC Name | 2-azabicyclo[4.1.0]hepta-1(6),2,4-triene;formic acid |
| SMILES | O=CO.c1cnc2c(c1)C2 |
| InChI | InChI=1S/C6H5N.CH2O2/c1-2-5-4-6(5)7-3-1;2-1-3/h1-3H,4H2;1H,(H,2,3) |
| InChIKey | SNJXPUWUYTWCSV-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.14 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-azabicyclo[4.1.0]hepta-1(6),2,4-triene;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azabicyclo[4.1.0]hepta-1(6),2,4-triene;formic acid?
The IUPAC name of 2-azabicyclo[4.1.0]hepta-1(6),2,4-triene;formic acid (CID 174744482) is 2-azabicyclo[4.1.0]hepta-1(6),2,4-triene;formic acid.
What is the SMILES notation for 2-azabicyclo[4.1.0]hepta-1(6),2,4-triene;formic acid?
The canonical SMILES for 2-azabicyclo[4.1.0]hepta-1(6),2,4-triene;formic acid is O=CO.c1cnc2c(c1)C2.
What is the InChIKey of 2-azabicyclo[4.1.0]hepta-1(6),2,4-triene;formic acid?
The InChIKey is SNJXPUWUYTWCSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N.CH2O2/c1-2-5-4-6(5)7-3-1;2-1-3/h1-3H,4H2;1H,(H,2,3).
What are the key properties of 2-azabicyclo[4.1.0]hepta-1(6),2,4-triene;formic acid?
2-azabicyclo[4.1.0]hepta-1(6),2,4-triene;formic acid has a molecular weight of 137.14 g/mol, XLogP of 0.69, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azabicyclo[4.1.0]hepta-1(6),2,4-triene;formic acid is sourced from PubChem (CID 174744482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).