C18H20Cl2N2 — CID 174744693
1-[3-[(2,6-dichlorophenyl)methyl]phenyl]-4-methylpiperazine (PubChem CID 174744693) has the molecular formula C18H20Cl2N2 and a molecular weight of 335.28 g/mol. Its IUPAC name is 1-[3-[(2,6-dichlorophenyl)methyl]phenyl]-4-methylpiperazine.
| Compound Name | 1-[3-[(2,6-dichlorophenyl)methyl]phenyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 174744693 |
| Molecular Formula | C18H20Cl2N2 |
| Molecular Weight | 335.28 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 1-[3-[(2,6-dichlorophenyl)methyl]phenyl]-4-methylpiperazine |
| SMILES | CN1CCN(c2cccc(Cc3c(Cl)cccc3Cl)c2)CC1 |
| InChI | InChI=1S/C18H20Cl2N2/c1-21-8-10-22(11-9-21)15-5-2-4-14(12-15)13-16-17(19)6-3-7-18(16)20/h2-7,12H,8-11,13H2,1H3 |
| InChIKey | RQJGNUWBFAWCGV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.28 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |