About 3-pentyl-2,5-dipropylpyridine
3-pentyl-2,5-dipropylpyridine (PubChem CID 174744841) has the molecular formula C16H27N
and a molecular weight of 233.40 g/mol. Its IUPAC name is 3-pentyl-2,5-dipropylpyridine.
Molecular Properties
| Compound Name | 3-pentyl-2,5-dipropylpyridine |
| PubChem CID | 174744841 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | 3-pentyl-2,5-dipropylpyridine |
| SMILES | CCCCCc1cc(CCC)cnc1CCC |
| InChI | InChI=1S/C16H27N/c1-4-7-8-11-15-12-14(9-5-2)13-17-16(15)10-6-3/h12-13H,4-11H2,1-3H3 |
| InChIKey | SPEIDIRTRRKLME-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-pentyl-2,5-dipropylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pentyl-2,5-dipropylpyridine?
The IUPAC name of 3-pentyl-2,5-dipropylpyridine (CID 174744841) is 3-pentyl-2,5-dipropylpyridine.
What is the SMILES notation for 3-pentyl-2,5-dipropylpyridine?
The canonical SMILES for 3-pentyl-2,5-dipropylpyridine is CCCCCc1cc(CCC)cnc1CCC.
What is the InChIKey of 3-pentyl-2,5-dipropylpyridine?
The InChIKey is SPEIDIRTRRKLME-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27N/c1-4-7-8-11-15-12-14(9-5-2)13-17-16(15)10-6-3/h12-13H,4-11H2,1-3H3.
What are the key properties of 3-pentyl-2,5-dipropylpyridine?
3-pentyl-2,5-dipropylpyridine has a molecular weight of 233.40 g/mol, XLogP of 4.72, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pentyl-2,5-dipropylpyridine is sourced from PubChem (CID 174744841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).