C15H7NO4S — CID 174744854
5,7-dihydroxynaphtho[3,2-g][1,3]benzothiazole-6,11-dione (PubChem CID 174744854) has the molecular formula C15H7NO4S and a molecular weight of 297.29 g/mol. Its IUPAC name is 5,7-dihydroxynaphtho[3,2-g][1,3]benzothiazole-6,11-dione.
| Compound Name | 5,7-dihydroxynaphtho[3,2-g][1,3]benzothiazole-6,11-dione |
|---|---|
| PubChem CID | 174744854 |
| Molecular Formula | C15H7NO4S |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | 5,7-dihydroxynaphtho[3,2-g][1,3]benzothiazole-6,11-dione |
| SMILES | O=C1c2c(O)cccc2C(=O)c2c1c(O)cc1ncsc21 |
| InChI | InChI=1S/C15H7NO4S/c17-8-3-1-2-6-10(8)14(20)11-9(18)4-7-15(21-5-16-7)12(11)13(6)19/h1-5,17-18H |
| InChIKey | HZHSBWXPSKDKLX-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|