C24H26BrN3O3 — CID 17474507
2-[[5-(4-bromophenyl)furan-2-yl]methyl-methylamino]-N-(2-morpholin-4-ylphenyl)acetamide (PubChem CID 17474507) has the molecular formula C24H26BrN3O3 and a molecular weight of 484.39 g/mol. Its IUPAC name is 2-[[5-(4-bromophenyl)furan-2-yl]methyl-methylamino]-N-(2-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[[5-(4-bromophenyl)furan-2-yl]methyl-methylamino]-N-(2-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 17474507 |
| Molecular Formula | C24H26BrN3O3 |
| Molecular Weight | 484.39 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | 2-[[5-(4-bromophenyl)furan-2-yl]methyl-methylamino]-N-(2-morpholin-4-ylphenyl)acetamide |
| SMILES | CN(CC(=O)Nc1ccccc1N1CCOCC1)Cc1ccc(-c2ccc(Br)cc2)o1 |
| InChI | InChI=1S/C24H26BrN3O3/c1-27(16-20-10-11-23(31-20)18-6-8-19(25)9-7-18)17-24(29)26-21-4-2-3-5-22(21)28-12-14-30-15-13-28/h2-11H,12-17H2,1H3,(H,26,29) |
| InChIKey | BJPFJACYYAMWDU-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.39 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |