C18H13N5O3 — CID 174745524
acridine;7,9-dihydro-3H-purine-2,6,8-trione (PubChem CID 174745524) has the molecular formula C18H13N5O3 and a molecular weight of 347.33 g/mol. Its IUPAC name is acridine;7,9-dihydro-3H-purine-2,6,8-trione.
| Compound Name | acridine;7,9-dihydro-3H-purine-2,6,8-trione |
|---|---|
| PubChem CID | 174745524 |
| Molecular Formula | C18H13N5O3 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | acridine;7,9-dihydro-3H-purine-2,6,8-trione |
| SMILES | O=c1[nH]c(=O)c2[nH]c(=O)[nH]c2[nH]1.c1ccc2nc3ccccc3cc2c1 |
| InChI | InChI=1S/C13H9N.C5H4N4O3/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12;10-3-1-2(7-4(11)6-1)8-5(12)9-3/h1-9H;(H4,6,7,8,9,10,11,12) |
| InChIKey | YVSMNZIUTCPCQE-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 127.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|