C21H34O4 — CID 174745773
methyl 2-acetyl-3-[(6Z,9Z)-pentadeca-6,9-dienyl]oxirane-2-carboxylate (PubChem CID 174745773) has the molecular formula C21H34O4 and a molecular weight of 350.50 g/mol. Its IUPAC name is methyl 2-acetyl-3-[(6Z,9Z)-pentadeca-6,9-dienyl]oxirane-2-carboxylate.
| Compound Name | methyl 2-acetyl-3-[(6Z,9Z)-pentadeca-6,9-dienyl]oxirane-2-carboxylate |
|---|---|
| PubChem CID | 174745773 |
| Molecular Formula | C21H34O4 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | methyl 2-acetyl-3-[(6Z,9Z)-pentadeca-6,9-dienyl]oxirane-2-carboxylate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCC1OC1(C(C)=O)C(=O)OC |
| InChI | InChI=1S/C21H34O4/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19-21(25-19,18(2)22)20(23)24-3/h8-9,11-12,19H,4-7,10,13-17H2,1-3H3/b9-8-,12-11- |
| InChIKey | DIWGVRKNULVHIN-MURFETPASA-N |
| XLogP | 4.92 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|