molecular hydrogen;pyrazine

C4H8N2 — CID 174745965

IUPACmolecular hydrogen;pyrazine
SMILES[H][H].[H][H].c1cnccn1
InChIInChI=1S/C4H4N2.2H2/c1-2-6-4-3-5-1;;/h1-4H;2*1H
InChIKeyRPPFUOWWLFQVAM-UHFFFAOYSA-N
MW84.12 g/mol
LogP0.97
Rot. Bonds

About molecular hydrogen;pyrazine

molecular hydrogen;pyrazine (PubChem CID 174745965) has the molecular formula C4H8N2 and a molecular weight of 84.12 g/mol. Its IUPAC name is molecular hydrogen;pyrazine.

Molecular Properties

Compound Namemolecular hydrogen;pyrazine
PubChem CID174745965
Molecular FormulaC4H8N2
Molecular Weight84.12 g/mol
Exact Mass84.07
IUPAC Namemolecular hydrogen;pyrazine
SMILES[H][H].[H][H].c1cnccn1
InChIInChI=1S/C4H4N2.2H2/c1-2-6-4-3-5-1;;/h1-4H;2*1H
InChIKeyRPPFUOWWLFQVAM-UHFFFAOYSA-N
XLogP0.97
TPSA25.78 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms6
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 50084.12
LogP ≤ 50.97
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze molecular hydrogen;pyrazine with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of molecular hydrogen;pyrazine?
The IUPAC name of molecular hydrogen;pyrazine (CID 174745965) is molecular hydrogen;pyrazine.
What is the SMILES notation for molecular hydrogen;pyrazine?
The canonical SMILES for molecular hydrogen;pyrazine is [H][H].[H][H].c1cnccn1.
What is the InChIKey of molecular hydrogen;pyrazine?
The InChIKey is RPPFUOWWLFQVAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N2.2H2/c1-2-6-4-3-5-1;;/h1-4H;2*1H.
What are the key properties of molecular hydrogen;pyrazine?
molecular hydrogen;pyrazine has a molecular weight of 84.12 g/mol, XLogP of 0.97, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;pyrazine is sourced from PubChem (CID 174745965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).