About 2H-chromene;copper;zirconium
2H-chromene;copper;zirconium (PubChem CID 174745994) has the molecular formula C9H8Cu2OZr
and a molecular weight of 350.48 g/mol. Its IUPAC name is 2H-chromene;copper;zirconium.
Molecular Properties
| Compound Name | 2H-chromene;copper;zirconium |
| PubChem CID | 174745994 |
| Molecular Formula | C9H8Cu2OZr |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 347.82 |
| IUPAC Name | 2H-chromene;copper;zirconium |
| SMILES | C1=Cc2ccccc2OC1.[Cu].[Cu].[Zr] |
| InChI | InChI=1S/C9H8O.2Cu.Zr/c1-2-6-9-8(4-1)5-3-7-10-9;;;/h1-6H,7H2;;; |
| InChIKey | BBSJLEPUUJGUEB-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2H-chromene;copper;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-chromene;copper;zirconium?
The IUPAC name of 2H-chromene;copper;zirconium (CID 174745994) is 2H-chromene;copper;zirconium.
What is the SMILES notation for 2H-chromene;copper;zirconium?
The canonical SMILES for 2H-chromene;copper;zirconium is C1=Cc2ccccc2OC1.[Cu].[Cu].[Zr].
What is the InChIKey of 2H-chromene;copper;zirconium?
The InChIKey is BBSJLEPUUJGUEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O.2Cu.Zr/c1-2-6-9-8(4-1)5-3-7-10-9;;;/h1-6H,7H2;;;.
What are the key properties of 2H-chromene;copper;zirconium?
2H-chromene;copper;zirconium has a molecular weight of 350.48 g/mol, XLogP of 2.08, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-chromene;copper;zirconium is sourced from PubChem (CID 174745994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).