About 1-(1-bromoethyl)-2,3,5-trichlorobenzene
1-(1-bromoethyl)-2,3,5-trichlorobenzene (PubChem CID 174746168) has the molecular formula C8H6BrCl3
and a molecular weight of 288.40 g/mol. Its IUPAC name is 1-(1-bromoethyl)-2,3,5-trichlorobenzene.
Molecular Properties
| Compound Name | 1-(1-bromoethyl)-2,3,5-trichlorobenzene |
| PubChem CID | 174746168 |
| Molecular Formula | C8H6BrCl3 |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 285.87 |
| IUPAC Name | 1-(1-bromoethyl)-2,3,5-trichlorobenzene |
| SMILES | CC(Br)c1cc(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C8H6BrCl3/c1-4(9)6-2-5(10)3-7(11)8(6)12/h2-4H,1H3 |
| InChIKey | BJBHKCHPPXMXAM-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-bromoethyl)-2,3,5-trichlorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-bromoethyl)-2,3,5-trichlorobenzene?
The IUPAC name of 1-(1-bromoethyl)-2,3,5-trichlorobenzene (CID 174746168) is 1-(1-bromoethyl)-2,3,5-trichlorobenzene.
What is the SMILES notation for 1-(1-bromoethyl)-2,3,5-trichlorobenzene?
The canonical SMILES for 1-(1-bromoethyl)-2,3,5-trichlorobenzene is CC(Br)c1cc(Cl)cc(Cl)c1Cl.
What is the InChIKey of 1-(1-bromoethyl)-2,3,5-trichlorobenzene?
The InChIKey is BJBHKCHPPXMXAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6BrCl3/c1-4(9)6-2-5(10)3-7(11)8(6)12/h2-4H,1H3.
What are the key properties of 1-(1-bromoethyl)-2,3,5-trichlorobenzene?
1-(1-bromoethyl)-2,3,5-trichlorobenzene has a molecular weight of 288.40 g/mol, XLogP of 5.10, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-bromoethyl)-2,3,5-trichlorobenzene is sourced from PubChem (CID 174746168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).