About cyclopenta-1,3-diene;3-cyclopentyl-1,1-bis(methoxymethyl)cyclopentane
cyclopenta-1,3-diene;3-cyclopentyl-1,1-bis(methoxymethyl)cyclopentane (PubChem CID 174746399) has the molecular formula C19H32O2
and a molecular weight of 292.46 g/mol. Its IUPAC name is cyclopenta-1,3-diene;3-cyclopentyl-1,1-bis(methoxymethyl)cyclopentane.
Molecular Properties
| Compound Name | cyclopenta-1,3-diene;3-cyclopentyl-1,1-bis(methoxymethyl)cyclopentane |
| PubChem CID | 174746399 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | cyclopenta-1,3-diene;3-cyclopentyl-1,1-bis(methoxymethyl)cyclopentane |
| SMILES | C1=CCC=C1.COCC1(COC)CCC(C2CCCC2)C1 |
| InChI | InChI=1S/C14H26O2.C5H6/c1-15-10-14(11-16-2)8-7-13(9-14)12-5-3-4-6-12;1-2-4-5-3-1/h12-13H,3-11H2,1-2H3;1-4H,5H2 |
| InChIKey | WLSUWEBSQZUJAC-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclopenta-1,3-diene;3-cyclopentyl-1,1-bis(methoxymethyl)cyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-1,3-diene;3-cyclopentyl-1,1-bis(methoxymethyl)cyclopentane?
The IUPAC name of cyclopenta-1,3-diene;3-cyclopentyl-1,1-bis(methoxymethyl)cyclopentane (CID 174746399) is cyclopenta-1,3-diene;3-cyclopentyl-1,1-bis(methoxymethyl)cyclopentane.
What is the SMILES notation for cyclopenta-1,3-diene;3-cyclopentyl-1,1-bis(methoxymethyl)cyclopentane?
The canonical SMILES for cyclopenta-1,3-diene;3-cyclopentyl-1,1-bis(methoxymethyl)cyclopentane is C1=CCC=C1.COCC1(COC)CCC(C2CCCC2)C1.
What is the InChIKey of cyclopenta-1,3-diene;3-cyclopentyl-1,1-bis(methoxymethyl)cyclopentane?
The InChIKey is WLSUWEBSQZUJAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O2.C5H6/c1-15-10-14(11-16-2)8-7-13(9-14)12-5-3-4-6-12;1-2-4-5-3-1/h12-13H,3-11H2,1-2H3;1-4H,5H2.
What are the key properties of cyclopenta-1,3-diene;3-cyclopentyl-1,1-bis(methoxymethyl)cyclopentane?
cyclopenta-1,3-diene;3-cyclopentyl-1,1-bis(methoxymethyl)cyclopentane has a molecular weight of 292.46 g/mol, XLogP of 4.76, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-1,3-diene;3-cyclopentyl-1,1-bis(methoxymethyl)cyclopentane is sourced from PubChem (CID 174746399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).