C15H21NO4 — CID 174746412
tert-butyl formate;1-(1H-indol-2-yl)ethane-1,2-diol (PubChem CID 174746412) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is tert-butyl formate;1-(1H-indol-2-yl)ethane-1,2-diol.
| Compound Name | tert-butyl formate;1-(1H-indol-2-yl)ethane-1,2-diol |
|---|---|
| PubChem CID | 174746412 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | tert-butyl formate;1-(1H-indol-2-yl)ethane-1,2-diol |
| SMILES | CC(C)(C)OC=O.OCC(O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C10H11NO2.C5H10O2/c12-6-10(13)9-5-7-3-1-2-4-8(7)11-9;1-5(2,3)7-4-6/h1-5,10-13H,6H2;4H,1-3H3 |
| InChIKey | PMQXQNSZPZBLFX-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|