C27H32N6O6 — CID 174746525
(3S)-3-[4-[4-[3-(2,4-dihydroxy-5-propan-2-ylphenyl)-5-oxo-1H-1,2,4-triazol-4-yl]phenyl]piperazine-1-carbonyl]-2-iminopentanoic acid (PubChem CID 174746525) has the molecular formula C27H32N6O6 and a molecular weight of 536.59 g/mol. Its IUPAC name is (3S)-3-[4-[4-[3-(2,4-dihydroxy-5-propan-2-ylphenyl)-5-oxo-1H-1,2,4-triazol-4-yl]phenyl]piperazine-1-carbonyl]-2-iminopentanoic acid.
| Compound Name | (3S)-3-[4-[4-[3-(2,4-dihydroxy-5-propan-2-ylphenyl)-5-oxo-1H-1,2,4-triazol-4-yl]phenyl]piperazine-1-carbonyl]-2-iminopentanoic acid |
|---|---|
| PubChem CID | 174746525 |
| Molecular Formula | C27H32N6O6 |
| Molecular Weight | 536.59 g/mol |
| Exact Mass | 536.24 |
| IUPAC Name | (3S)-3-[4-[4-[3-(2,4-dihydroxy-5-propan-2-ylphenyl)-5-oxo-1H-1,2,4-triazol-4-yl]phenyl]piperazine-1-carbonyl]-2-iminopentanoic acid |
| SMILES | [H]/N=C(\C(=O)O)[C@H](CC)C(=O)N1CCN(c2ccc(-n3c(-c4cc(C(C)C)c(O)cc4O)n[nH]c3=O)cc2)CC1 |
| InChI | InChI=1S/C27H32N6O6/c1-4-18(23(28)26(37)38)25(36)32-11-9-31(10-12-32)16-5-7-17(8-6-16)33-24(29-30-27(33)39)20-13-19(15(2)3)21(34)14-22(20)35/h5-8,13-15,18,28,34-35H,4,9-12H2,1-3H3,(H,30,39)(H,37,38)/b28-23-/t18-/m0/s1 |
| InChIKey | QAAFUGODEMYKKK-DFYKEDFYSA-N |
| XLogP | 2.54 |
| TPSA | 175.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.59 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|